C10H13N3 — CID 155085164
N,5-dimethyl-4a,5-dihydro-1H-1,6-naphthyridin-2-imine (PubChem CID 155085164) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N,5-dimethyl-4a,5-dihydro-1H-1,6-naphthyridin-2-imine.
| Compound Name | N,5-dimethyl-4a,5-dihydro-1H-1,6-naphthyridin-2-imine |
|---|---|
| PubChem CID | 155085164 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N,5-dimethyl-4a,5-dihydro-1H-1,6-naphthyridin-2-imine |
| SMILES | C/N=C1\C=CC2C(=CC=NC2C)N1 |
| InChI | InChI=1S/C10H13N3/c1-7-8-3-4-10(11-2)13-9(8)5-6-12-7/h3-8H,1-2H3,(H,11,13) |
| InChIKey | GHCVVPPGPOMZJG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|