About 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene
8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 15508540) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene.
Molecular Properties
| Compound Name | 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene |
| PubChem CID | 15508540 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C=COCCOCC1C2CC(C3CC=CC23)C1COCCOC=C |
| InChI | InChI=1S/C20H30O4/c1-3-21-8-10-23-13-19-17-12-18(16-7-5-6-15(16)17)20(19)14-24-11-9-22-4-2/h3-6,15-20H,1-2,7-14H2 |
| InChIKey | YDOADJNPTDAYCY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene?
The IUPAC name of 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene (CID 15508540) is 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene.
What is the SMILES notation for 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene?
The canonical SMILES for 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene is C=COCCOCC1C2CC(C3CC=CC23)C1COCCOC=C.
What is the InChIKey of 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene?
The InChIKey is YDOADJNPTDAYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O4/c1-3-21-8-10-23-13-19-17-12-18(16-7-5-6-15(16)17)20(19)14-24-11-9-22-4-2/h3-6,15-20H,1-2,7-14H2.
What are the key properties of 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene?
8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene has a molecular weight of 334.46 g/mol, XLogP of 3.41, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-bis(2-ethenoxyethoxymethyl)tricyclo[5.2.1.02,6]dec-3-ene is sourced from PubChem (CID 15508540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).