C16H23NO — CID 155085404
N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-N-methylcyclohexa-1,3-dien-1-amine (PubChem CID 155085404) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-N-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-N-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155085404 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-N-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CN(CCCOC1=CCCC=C1)C1=CC=CCC1 |
| InChI | InChI=1S/C16H23NO/c1-17(15-9-4-2-5-10-15)13-8-14-18-16-11-6-3-7-12-16/h2,4,6,9,11-12H,3,5,7-8,10,13-14H2,1H3 |
| InChIKey | MMIMFMKVFLSAJL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|