C17H21F2NO — CID 155085567
N-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]-2-(2-fluorophenyl)acetamide (PubChem CID 155085567) has the molecular formula C17H21F2NO and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 155085567 |
| Molecular Formula | C17H21F2NO |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]-2-(2-fluorophenyl)acetamide |
| SMILES | C/C=C(F)\C(NC(=O)Cc1ccccc1F)=C(\C)C(C)C |
| InChI | InChI=1S/C17H21F2NO/c1-5-14(18)17(12(4)11(2)3)20-16(21)10-13-8-6-7-9-15(13)19/h5-9,11H,10H2,1-4H3,(H,20,21)/b14-5+,17-12+ |
| InChIKey | IQXHHAJKONXJEO-XBHQGJDRSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|