C25H16ClF3N4OS2 — CID 155085599
N-[5-chloro-2-fluoro-4-[[6-(3-fluorophenyl)-4-(2-fluoro-4-pyridinyl)-1,2-dihydropyridin-3-yl]oxy]phenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 155085599) has the molecular formula C25H16ClF3N4OS2 and a molecular weight of 545.01 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-[[6-(3-fluorophenyl)-4-(2-fluoro-4-pyridinyl)-1,2-dihydropyridin-3-yl]oxy]phenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-[[6-(3-fluorophenyl)-4-(2-fluoro-4-pyridinyl)-1,2-dihydropyridin-3-yl]oxy]phenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 155085599 |
| Molecular Formula | C25H16ClF3N4OS2 |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-[[6-(3-fluorophenyl)-4-(2-fluoro-4-pyridinyl)-1,2-dihydropyridin-3-yl]oxy]phenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | Fc1cccc(C2=CC(c3ccnc(F)c3)=C(Oc3cc(F)c(SNc4cscn4)cc3Cl)CN2)c1 |
| InChI | InChI=1S/C25H16ClF3N4OS2/c26-18-9-23(36-33-25-12-35-13-32-25)19(28)10-21(18)34-22-11-31-20(15-2-1-3-16(27)6-15)8-17(22)14-4-5-30-24(29)7-14/h1-10,12-13,31,33H,11H2 |
| InChIKey | YDLXUFLYJACTQK-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|