C46H29N5 — CID 155086305
9-[2-[4-[4-[2-[(1Z)-buta-1,3-dienyl]-6-cyano-3-methylindol-1-yl]-2-cyanophenyl]phenyl]phenyl]carbazole-3-carbonitrile (PubChem CID 155086305) has the molecular formula C46H29N5 and a molecular weight of 651.77 g/mol. Its IUPAC name is 9-[2-[4-[4-[2-[(1Z)-buta-1,3-dienyl]-6-cyano-3-methylindol-1-yl]-2-cyanophenyl]phenyl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[2-[4-[4-[2-[(1Z)-buta-1,3-dienyl]-6-cyano-3-methylindol-1-yl]-2-cyanophenyl]phenyl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155086305 |
| Molecular Formula | C46H29N5 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | 9-[2-[4-[4-[2-[(1Z)-buta-1,3-dienyl]-6-cyano-3-methylindol-1-yl]-2-cyanophenyl]phenyl]phenyl]carbazole-3-carbonitrile |
| SMILES | C=C/C=C\c1c(C)c2ccc(C#N)cc2n1-c1ccc(-c2ccc(-c3ccccc3-n3c4ccccc4c4cc(C#N)ccc43)cc2)c(C#N)c1 |
| InChI | InChI=1S/C46H29N5/c1-3-4-11-42-30(2)37-21-14-32(28-48)25-46(37)50(42)36-20-22-38(35(26-36)29-49)33-16-18-34(19-17-33)39-9-5-7-12-43(39)51-44-13-8-6-10-40(44)41-24-31(27-47)15-23-45(41)51/h3-26H,1H2,2H3/b11-4- |
| InChIKey | DLSXQHISLKOQCD-WCIBSUBMSA-N |
| XLogP | 11.18 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|