C47H31N5 — CID 155086568
9-[3-[(2Z,4Z)-5-cyano-4-[2-(3-cyanocarbazol-9-yl)phenyl]octa-2,4,7-trien-3-yl]phenyl]carbazole-3-carbonitrile (PubChem CID 155086568) has the molecular formula C47H31N5 and a molecular weight of 665.80 g/mol. Its IUPAC name is 9-[3-[(2Z,4Z)-5-cyano-4-[2-(3-cyanocarbazol-9-yl)phenyl]octa-2,4,7-trien-3-yl]phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[3-[(2Z,4Z)-5-cyano-4-[2-(3-cyanocarbazol-9-yl)phenyl]octa-2,4,7-trien-3-yl]phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155086568 |
| Molecular Formula | C47H31N5 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | 9-[3-[(2Z,4Z)-5-cyano-4-[2-(3-cyanocarbazol-9-yl)phenyl]octa-2,4,7-trien-3-yl]phenyl]carbazole-3-carbonitrile |
| SMILES | C=CC/C(C#N)=C(C(=C/C)\c1cccc(-n2c3ccccc3c3cc(C#N)ccc32)c1)/c1ccccc1-n1c2ccccc2c2cc(C#N)ccc21 |
| InChI | InChI=1S/C47H31N5/c1-3-12-34(30-50)47(39-17-7-10-20-44(39)52-43-19-9-6-16-38(43)41-26-32(29-49)22-24-46(41)52)36(4-2)33-13-11-14-35(27-33)51-42-18-8-5-15-37(42)40-25-31(28-48)21-23-45(40)51/h3-11,13-27H,1,12H2,2H3/b36-4-,47-34- |
| InChIKey | UAZAJCZMVAVJPT-BCSQUMQASA-N |
| XLogP | 11.58 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|