C26H24F5N3O4 — CID 155086722
6-[3-[[4-[(1E,3Z)-1-amino-6,6,6-trifluoro-5-methylhexa-1,3-dien-2-yl]-2-fluorophenoxy]methyl]azetidine-1-carbonyl]-7-fluoro-4H-1,4-benzoxazin-3-one (PubChem CID 155086722) has the molecular formula C26H24F5N3O4 and a molecular weight of 537.49 g/mol. Its IUPAC name is 6-[3-[[4-[(1E,3Z)-1-amino-6,6,6-trifluoro-5-methylhexa-1,3-dien-2-yl]-2-fluorophenoxy]methyl]azetidine-1-carbonyl]-7-fluoro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[[4-[(1E,3Z)-1-amino-6,6,6-trifluoro-5-methylhexa-1,3-dien-2-yl]-2-fluorophenoxy]methyl]azetidine-1-carbonyl]-7-fluoro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 155086722 |
| Molecular Formula | C26H24F5N3O4 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 6-[3-[[4-[(1E,3Z)-1-amino-6,6,6-trifluoro-5-methylhexa-1,3-dien-2-yl]-2-fluorophenoxy]methyl]azetidine-1-carbonyl]-7-fluoro-4H-1,4-benzoxazin-3-one |
| SMILES | CC(/C=C\C(=C/N)c1ccc(OCC2CN(C(=O)c3cc4c(cc3F)OCC(=O)N4)C2)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C26H24F5N3O4/c1-14(26(29,30)31)2-3-17(9-32)16-4-5-22(20(28)6-16)37-12-15-10-34(11-15)25(36)18-7-21-23(8-19(18)27)38-13-24(35)33-21/h2-9,14-15H,10-13,32H2,1H3,(H,33,35)/b3-2-,17-9+ |
| InChIKey | YUGMWLDHLDVQLZ-MKDAFRRASA-N |
| XLogP | 4.50 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|