C24H31F4I2N — CID 155086759
N-[(5R)-5-ethyl-5-iodocyclohex-2-en-1-yl]-6-fluoro-4-methyl-N-[(3Z,5R)-3,4,8-trifluoro-7-iodo-5-methylocta-1,3-dien-2-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 155086759) has the molecular formula C24H31F4I2N and a molecular weight of 663.32 g/mol. Its IUPAC name is N-[(5R)-5-ethyl-5-iodocyclohex-2-en-1-yl]-6-fluoro-4-methyl-N-[(3Z,5R)-3,4,8-trifluoro-7-iodo-5-methylocta-1,3-dien-2-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | N-[(5R)-5-ethyl-5-iodocyclohex-2-en-1-yl]-6-fluoro-4-methyl-N-[(3Z,5R)-3,4,8-trifluoro-7-iodo-5-methylocta-1,3-dien-2-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 155086759 |
| Molecular Formula | C24H31F4I2N |
| Molecular Weight | 663.32 g/mol |
| Exact Mass | 663.05 |
| IUPAC Name | N-[(5R)-5-ethyl-5-iodocyclohex-2-en-1-yl]-6-fluoro-4-methyl-N-[(3Z,5R)-3,4,8-trifluoro-7-iodo-5-methylocta-1,3-dien-2-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | C=C(/C(F)=C(/F)[C@H](C)CC(I)CF)N(C1C=CC[C@](I)(CC)C1)C1C=CC(C)=CC1F |
| InChI | InChI=1S/C24H31F4I2N/c1-5-24(30)10-6-7-19(13-24)31(21-9-8-15(2)11-20(21)26)17(4)23(28)22(27)16(3)12-18(29)14-25/h6-9,11,16,18-21H,4-5,10,12-14H2,1-3H3/b23-22-/t16-,18?,19?,20?,21?,24-/m1/s1 |
| InChIKey | HIKAMMDJQKKBBH-NRWQTXQQSA-N |
| XLogP | 8.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.32 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|