C15H24O4S — CID 155087712
methyl 3-[[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]methylsulfanyl]propanoate (PubChem CID 155087712) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is methyl 3-[[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 155087712 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methyl 3-[[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCC1C[C@@H]2CC3(C[C@@H]2C1)OCCO3 |
| InChI | InChI=1S/C15H24O4S/c1-17-14(16)2-5-20-10-11-6-12-8-15(9-13(12)7-11)18-3-4-19-15/h11-13H,2-10H2,1H3/t11?,12-,13+ |
| InChIKey | YERCSDSRJKWRGV-YHWZYXNKSA-N |
| XLogP | 2.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|