C24H23ClFN3O — CID 155087743
N-[[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-6-chloropyridine-3-carboxamide (PubChem CID 155087743) has the molecular formula C24H23ClFN3O and a molecular weight of 423.92 g/mol. Its IUPAC name is N-[[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 155087743 |
| Molecular Formula | C24H23ClFN3O |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[[(3aS,6aR)-5-(6-fluoroquinolin-4-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-6-chloropyridine-3-carboxamide |
| SMILES | O=C(NCC1C[C@@H]2CC(c3ccnc4ccc(F)cc34)C[C@@H]2C1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C24H23ClFN3O/c25-23-4-1-15(13-28-23)24(30)29-12-14-7-16-9-18(10-17(16)8-14)20-5-6-27-22-3-2-19(26)11-21(20)22/h1-6,11,13-14,16-18H,7-10,12H2,(H,29,30)/t14?,16-,17+,18? |
| InChIKey | RHOOWXGZXZTNCA-JGAFYBCUSA-N |
| XLogP | 5.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|