About [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate
[2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate (PubChem CID 15508794) has the molecular formula C35H28O5S
and a molecular weight of 560.67 g/mol. Its IUPAC name is [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate.
Molecular Properties
| Compound Name | [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate |
| PubChem CID | 15508794 |
| Molecular Formula | C35H28O5S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(Sc4ccccc4)c(OC(C)=O)c4ccccc4c3O2)cc1 |
| InChI | InChI=1S/C35H28O5S/c1-23(36)39-33-30-12-8-7-11-29(30)32-31(34(33)41-28-9-5-4-6-10-28)21-22-35(40-32,24-13-17-26(37-2)18-14-24)25-15-19-27(38-3)20-16-25/h4-22H,1-3H3 |
| InChIKey | KBUYRNUUCPJDFM-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate?
The IUPAC name of [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate (CID 15508794) is [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate.
What is the SMILES notation for [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate?
The canonical SMILES for [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate is COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(Sc4ccccc4)c(OC(C)=O)c4ccccc4c3O2)cc1.
What is the InChIKey of [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate?
The InChIKey is KBUYRNUUCPJDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H28O5S/c1-23(36)39-33-30-12-8-7-11-29(30)32-31(34(33)41-28-9-5-4-6-10-28)21-22-35(40-32,24-13-17-26(37-2)18-14-24)25-15-19-27(38-3)20-16-25/h4-22H,1-3H3.
What are the key properties of [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate?
[2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate has a molecular weight of 560.67 g/mol, XLogP of 8.28, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-bis(4-methoxyphenyl)-5-phenylsulfanylbenzo[h]chromen-6-yl] acetate is sourced from PubChem (CID 15508794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).