C11H13F3O5S — CID 155087969
[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl] trifluoromethanesulfonate (PubChem CID 155087969) has the molecular formula C11H13F3O5S and a molecular weight of 314.28 g/mol. Its IUPAC name is [(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl] trifluoromethanesulfonate.
| Compound Name | [(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155087969 |
| Molecular Formula | C11H13F3O5S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | [(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=C[C@@H]2CC3(C[C@@H]2C1)OCCO3)C(F)(F)F |
| InChI | InChI=1S/C11H13F3O5S/c12-11(13,14)20(15,16)19-9-3-7-5-10(6-8(7)4-9)17-1-2-18-10/h3,7-8H,1-2,4-6H2/t7-,8+/m1/s1 |
| InChIKey | IDJPURMBSMHTCT-SFYZADRCSA-N |
| XLogP | 1.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|