About N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine
N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine (PubChem CID 155088007) has the molecular formula C18H26N2S
and a molecular weight of 302.49 g/mol. Its IUPAC name is N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine |
| PubChem CID | 155088007 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine |
| SMILES | Cc1cc(C)c(-c2cccc(NCS(C)(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C18H26N2S/c1-13-10-14(2)18(15(3)11-13)16-8-7-9-17(20-16)19-12-21(4,5)6/h7-11H,12H2,1-6H3,(H,19,20) |
| InChIKey | QSQOXFHIBQLGSI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine?
The IUPAC name of N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine (CID 155088007) is N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine.
What is the SMILES notation for N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine?
The canonical SMILES for N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine is Cc1cc(C)c(-c2cccc(NCS(C)(C)C)n2)c(C)c1.
What is the InChIKey of N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine?
The InChIKey is QSQOXFHIBQLGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2S/c1-13-10-14(2)18(15(3)11-13)16-8-7-9-17(20-16)19-12-21(4,5)6/h7-11H,12H2,1-6H3,(H,19,20).
What are the key properties of N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine?
N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine has a molecular weight of 302.49 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(trimethyl-λ4-sulfanyl)methyl]-6-(2,4,6-trimethylphenyl)pyridin-2-amine is sourced from PubChem (CID 155088007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).