C14H23NO — CID 155088575
(4S,5E,6Z)-3-(ethylamino)-5-prop-2-enylidenenona-6,8-dien-4-ol (PubChem CID 155088575) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (4S,5E,6Z)-3-(ethylamino)-5-prop-2-enylidenenona-6,8-dien-4-ol.
| Compound Name | (4S,5E,6Z)-3-(ethylamino)-5-prop-2-enylidenenona-6,8-dien-4-ol |
|---|---|
| PubChem CID | 155088575 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (4S,5E,6Z)-3-(ethylamino)-5-prop-2-enylidenenona-6,8-dien-4-ol |
| SMILES | C=C/C=C\C(=C/C=C)[C@H](O)C(CC)NCC |
| InChI | InChI=1S/C14H23NO/c1-5-9-11-12(10-6-2)14(16)13(7-3)15-8-4/h5-6,9-11,13-16H,1-2,7-8H2,3-4H3/b11-9-,12-10+/t13?,14-/m0/s1 |
| InChIKey | JXKSMJJIZNTAGB-RHQDDJGPSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|