About N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide
N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide (PubChem CID 155089010) has the molecular formula C16H16F3N3O
and a molecular weight of 323.32 g/mol. Its IUPAC name is N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide |
| PubChem CID | 155089010 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide |
| SMILES | O=C(NCN1CCCC(F)(F)C1)c1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C16H16F3N3O/c17-13-4-1-3-11-7-12(8-20-14(11)13)15(23)21-10-22-6-2-5-16(18,19)9-22/h1,3-4,7-8H,2,5-6,9-10H2,(H,21,23) |
| InChIKey | GFKKFZRVXDPWHY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide?
The IUPAC name of N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide (CID 155089010) is N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide.
What is the SMILES notation for N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide?
The canonical SMILES for N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide is O=C(NCN1CCCC(F)(F)C1)c1cnc2c(F)cccc2c1.
What is the InChIKey of N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide?
The InChIKey is GFKKFZRVXDPWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3N3O/c17-13-4-1-3-11-7-12(8-20-14(11)13)15(23)21-10-22-6-2-5-16(18,19)9-22/h1,3-4,7-8H,2,5-6,9-10H2,(H,21,23).
What are the key properties of N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide?
N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide has a molecular weight of 323.32 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluoropiperidin-1-yl)methyl]-8-fluoroquinoline-3-carboxamide is sourced from PubChem (CID 155089010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).