C19H21Cl2N5O — CID 155089518
5-(2,3-dichlorophenyl)-6-methyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-4-carboxamide (PubChem CID 155089518) has the molecular formula C19H21Cl2N5O and a molecular weight of 406.32 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-6-methyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-4-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-6-methyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 155089518 |
| Molecular Formula | C19H21Cl2N5O |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-6-methyl-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(N2CC3CN(C)CC3C2)nc(C(N)=O)c1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H21Cl2N5O/c1-10-15(13-4-3-5-14(20)16(13)21)17(18(22)27)24-19(23-10)26-8-11-6-25(2)7-12(11)9-26/h3-5,11-12H,6-9H2,1-2H3,(H2,22,27) |
| InChIKey | KETZUNJWEVGBTA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |