C25H28ClF4N5O3 — CID 155089692
4-chloro-5-[4-[4-fluoro-2-(trifluoromethyl)anilino]-1-methyl-1-oxido-2,3,4,4a,5,6-hexahydro-1,7-naphthyridin-1-ium-7-yl]-2-(oxan-2-yl)pyridazin-3-one (PubChem CID 155089692) has the molecular formula C25H28ClF4N5O3 and a molecular weight of 557.98 g/mol. Its IUPAC name is 4-chloro-5-[4-[4-fluoro-2-(trifluoromethyl)anilino]-1-methyl-1-oxido-2,3,4,4a,5,6-hexahydro-1,7-naphthyridin-1-ium-7-yl]-2-(oxan-2-yl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[4-[4-fluoro-2-(trifluoromethyl)anilino]-1-methyl-1-oxido-2,3,4,4a,5,6-hexahydro-1,7-naphthyridin-1-ium-7-yl]-2-(oxan-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 155089692 |
| Molecular Formula | C25H28ClF4N5O3 |
| Molecular Weight | 557.98 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 4-chloro-5-[4-[4-fluoro-2-(trifluoromethyl)anilino]-1-methyl-1-oxido-2,3,4,4a,5,6-hexahydro-1,7-naphthyridin-1-ium-7-yl]-2-(oxan-2-yl)pyridazin-3-one |
| SMILES | C[N+]1([O-])CCC(Nc2ccc(F)cc2C(F)(F)F)C2CCN(c3cnn(C4CCCCO4)c(=O)c3Cl)C=C21 |
| InChI | InChI=1S/C25H28ClF4N5O3/c1-35(37)10-8-18(32-19-6-5-15(27)12-17(19)25(28,29)30)16-7-9-33(14-21(16)35)20-13-31-34(24(36)23(20)26)22-4-2-3-11-38-22/h5-6,12-14,16,18,22,32H,2-4,7-11H2,1H3 |
| InChIKey | HOMWMFQVVQYCHP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.98 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|