C17H20F3N3O5 — CID 155089767
methyl 2-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 155089767) has the molecular formula C17H20F3N3O5 and a molecular weight of 403.36 g/mol. Its IUPAC name is methyl 2-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155089767 |
| Molecular Formula | C17H20F3N3O5 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | methyl 2-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)Cc1ccc(N2C[C@@H]3CNCCN3C2=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N3O3.C2HF3O2/c1-21-14(19)8-11-2-4-12(5-3-11)18-10-13-9-16-6-7-17(13)15(18)20;3-2(4,5)1(6)7/h2-5,13,16H,6-10H2,1H3;(H,6,7)/t13-;/m0./s1 |
| InChIKey | HPYIGTYHUCBPEG-ZOWNYOTGSA-N |
| XLogP | 1.25 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |