C24H21F6N3O7 — CID 155090091
(5S)-5-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid (PubChem CID 155090091) has the molecular formula C24H21F6N3O7 and a molecular weight of 577.43 g/mol. Its IUPAC name is (5S)-5-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid.
| Compound Name | (5S)-5-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid |
|---|---|
| PubChem CID | 155090091 |
| Molecular Formula | C24H21F6N3O7 |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | (5S)-5-[[(2S)-2-[[2-(2,6-difluoroanilino)-2-oxoacetyl]amino]propanoyl]amino]-6-oxo-7-(2,3,5,6-tetrafluorophenoxy)heptanoic acid |
| SMILES | C[C@H](NC(=O)C(=O)Nc1c(F)cccc1F)C(=O)N[C@@H](CCCC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H21F6N3O7/c1-10(31-23(38)24(39)33-20-11(25)4-2-5-12(20)26)22(37)32-15(6-3-7-17(35)36)16(34)9-40-21-18(29)13(27)8-14(28)19(21)30/h2,4-5,8,10,15H,3,6-7,9H2,1H3,(H,31,38)(H,32,37)(H,33,39)(H,35,36)/t10-,15-/m0/s1 |
| InChIKey | YOTBLGHOTSAUJO-BONVTDFDSA-N |
| XLogP | 2.35 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|