About 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride
4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride (PubChem CID 155090147) has the molecular formula C11H13ClF3N3O4
and a molecular weight of 343.69 g/mol. Its IUPAC name is 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride |
| PubChem CID | 155090147 |
| Molecular Formula | C11H13ClF3N3O4 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride |
| SMILES | Cl.NC(CCC(=O)O)C(=O)COc1ccnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F3N3O4.ClH/c12-11(13,14)10-16-4-3-8(17-10)21-5-7(18)6(15)1-2-9(19)20;/h3-4,6H,1-2,5,15H2,(H,19,20);1H |
| InChIKey | BEPQPJJRIVAXIB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride?
The IUPAC name of 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride (CID 155090147) is 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride.
What is the SMILES notation for 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride?
The canonical SMILES for 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride is Cl.NC(CCC(=O)O)C(=O)COc1ccnc(C(F)(F)F)n1.
What is the InChIKey of 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride?
The InChIKey is BEPQPJJRIVAXIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N3O4.ClH/c12-11(13,14)10-16-4-3-8(17-10)21-5-7(18)6(15)1-2-9(19)20;/h3-4,6H,1-2,5,15H2,(H,19,20);1H.
What are the key properties of 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride?
4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride has a molecular weight of 343.69 g/mol, XLogP of 1.06, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-oxo-6-[2-(trifluoromethyl)pyrimidin-4-yl]oxyhexanoic acid;hydrochloride is sourced from PubChem (CID 155090147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).