About 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate
3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate (PubChem CID 155090718) has the molecular formula C22H25NO4
and a molecular weight of 367.44 g/mol. Its IUPAC name is 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate |
| PubChem CID | 155090718 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CN(Cc2ccccc2)C[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-2-26-21(24)19-14-23(13-17-9-5-3-6-10-17)15-20(19)22(25)27-16-18-11-7-4-8-12-18/h3-12,19-20H,2,13-16H2,1H3/t19-,20-/m0/s1 |
| InChIKey | VAPHPGAWDQAHSL-PMACEKPBSA-N |
| XLogP | 3.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate?
The IUPAC name of 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate (CID 155090718) is 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate.
What is the SMILES notation for 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate?
The canonical SMILES for 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate is CCOC(=O)[C@H]1CN(Cc2ccccc2)C[C@@H]1C(=O)OCc1ccccc1.
What is the InChIKey of 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate?
The InChIKey is VAPHPGAWDQAHSL-PMACEKPBSA-N. The full InChI is InChI=1S/C22H25NO4/c1-2-26-21(24)19-14-23(13-17-9-5-3-6-10-17)15-20(19)22(25)27-16-18-11-7-4-8-12-18/h3-12,19-20H,2,13-16H2,1H3/t19-,20-/m0/s1.
What are the key properties of 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate?
3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate has a molecular weight of 367.44 g/mol, XLogP of 3.04, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-benzyl 4-O-ethyl (3R,4R)-1-benzylpyrrolidine-3,4-dicarboxylate is sourced from PubChem (CID 155090718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).