C33H32N4O7S — CID 155091487
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 155091487) has the molecular formula C33H32N4O7S and a molecular weight of 628.71 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155091487 |
| Molecular Formula | C33H32N4O7S |
| Molecular Weight | 628.71 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | Cc1ccc2nc(-c3ccc(NCCOCCOCCOc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)sc2c1 |
| InChI | InChI=1S/C33H32N4O7S/c1-20-5-10-24-27(19-20)45-31(35-24)21-6-8-22(9-7-21)34-13-14-42-15-16-43-17-18-44-26-4-2-3-23-29(26)33(41)37(32(23)40)25-11-12-28(38)36-30(25)39/h2-10,19,25,34H,11-18H2,1H3,(H,36,38,39) |
| InChIKey | GOPSDVBTHNIRPX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|