About N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide
N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide (PubChem CID 155091776) has the molecular formula C16H22N2O
and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide |
| PubChem CID | 155091776 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide |
| SMILES | C=C/N=C(\C=C)N(/C=C(\C=C)C(C)(C)C)C(=O)C=C |
| InChI | InChI=1S/C16H22N2O/c1-8-13(16(5,6)7)12-18(15(19)10-3)14(9-2)17-11-4/h8-12H,1-4H2,5-7H3/b13-12+,17-14+ |
| InChIKey | JSBRBVHFYRIYNS-MIFVOYFBSA-N |
| XLogP | 3.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide?
The IUPAC name of N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide (CID 155091776) is N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide.
What is the SMILES notation for N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide?
The canonical SMILES for N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide is C=C/N=C(\C=C)N(/C=C(\C=C)C(C)(C)C)C(=O)C=C.
What is the InChIKey of N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide?
The InChIKey is JSBRBVHFYRIYNS-MIFVOYFBSA-N. The full InChI is InChI=1S/C16H22N2O/c1-8-13(16(5,6)7)12-18(15(19)10-3)14(9-2)17-11-4/h8-12H,1-4H2,5-7H3/b13-12+,17-14+.
What are the key properties of N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide?
N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide has a molecular weight of 258.37 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[C,N-bis(ethenyl)carbonimidoyl]-N-[(1E)-2-tert-butylbuta-1,3-dienyl]prop-2-enamide is sourced from PubChem (CID 155091776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).