About 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide
2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide (PubChem CID 155092335) has the molecular formula C3H4O2S
and a molecular weight of 104.13 g/mol. Its IUPAC name is 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide.
Molecular Properties
| Compound Name | 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide |
| PubChem CID | 155092335 |
| Molecular Formula | C3H4O2S |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 103.99 |
| IUPAC Name | 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide |
| SMILES | O=S1(=O)C2CC21 |
| InChI | InChI=1S/C3H4O2S/c4-6(5)2-1-3(2)6/h2-3H,1H2 |
| InChIKey | GULIQVHRHKDACO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide?
The IUPAC name of 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide (CID 155092335) is 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide.
What is the SMILES notation for 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide?
The canonical SMILES for 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide is O=S1(=O)C2CC21.
What is the InChIKey of 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide?
The InChIKey is GULIQVHRHKDACO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2S/c4-6(5)2-1-3(2)6/h2-3H,1H2.
What are the key properties of 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide?
2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide has a molecular weight of 104.13 g/mol, XLogP of -0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2λ6-thiabicyclo[1.1.0]butane 2,2-dioxide is sourced from PubChem (CID 155092335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).