C26H20FN3O4 — CID 155092418
N-[2-[4-(2-fluoro-6-hydroxy-3-methoxybenzoyl)anilino]phenyl]pyridine-4-carboxamide (PubChem CID 155092418) has the molecular formula C26H20FN3O4 and a molecular weight of 457.46 g/mol. Its IUPAC name is N-[2-[4-(2-fluoro-6-hydroxy-3-methoxybenzoyl)anilino]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[4-(2-fluoro-6-hydroxy-3-methoxybenzoyl)anilino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155092418 |
| Molecular Formula | C26H20FN3O4 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[2-[4-(2-fluoro-6-hydroxy-3-methoxybenzoyl)anilino]phenyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(O)c(C(=O)c2ccc(Nc3ccccc3NC(=O)c3ccncc3)cc2)c1F |
| InChI | InChI=1S/C26H20FN3O4/c1-34-22-11-10-21(31)23(24(22)27)25(32)16-6-8-18(9-7-16)29-19-4-2-3-5-20(19)30-26(33)17-12-14-28-15-13-17/h2-15,29,31H,1H3,(H,30,33) |
| InChIKey | DKDRGVLDNSYRTC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |