About [(1S)-2,2-difluorocyclobutyl]thiourea
[(1S)-2,2-difluorocyclobutyl]thiourea (PubChem CID 155092638) has the molecular formula C5H8F2N2S
and a molecular weight of 166.20 g/mol. Its IUPAC name is [(1S)-2,2-difluorocyclobutyl]thiourea.
Molecular Properties
| Compound Name | [(1S)-2,2-difluorocyclobutyl]thiourea |
| PubChem CID | 155092638 |
| Molecular Formula | C5H8F2N2S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | [(1S)-2,2-difluorocyclobutyl]thiourea |
| SMILES | NC(=S)N[C@H]1CCC1(F)F |
| InChI | InChI=1S/C5H8F2N2S/c6-5(7)2-1-3(5)9-4(8)10/h3H,1-2H2,(H3,8,9,10)/t3-/m0/s1 |
| InChIKey | HHTFOCAYFCBCDT-VKHMYHEASA-N |
| XLogP | 0.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2,2-difluorocyclobutyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-difluorocyclobutyl]thiourea?
The IUPAC name of [(1S)-2,2-difluorocyclobutyl]thiourea (CID 155092638) is [(1S)-2,2-difluorocyclobutyl]thiourea.
What is the SMILES notation for [(1S)-2,2-difluorocyclobutyl]thiourea?
The canonical SMILES for [(1S)-2,2-difluorocyclobutyl]thiourea is NC(=S)N[C@H]1CCC1(F)F.
What is the InChIKey of [(1S)-2,2-difluorocyclobutyl]thiourea?
The InChIKey is HHTFOCAYFCBCDT-VKHMYHEASA-N. The full InChI is InChI=1S/C5H8F2N2S/c6-5(7)2-1-3(5)9-4(8)10/h3H,1-2H2,(H3,8,9,10)/t3-/m0/s1.
What are the key properties of [(1S)-2,2-difluorocyclobutyl]thiourea?
[(1S)-2,2-difluorocyclobutyl]thiourea has a molecular weight of 166.20 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-difluorocyclobutyl]thiourea is sourced from PubChem (CID 155092638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).