C11H10O — CID 155093037
(3S)-tricyclo[5.2.1.02,6]deca-1,6,8-triene-3-carbaldehyde (PubChem CID 155093037) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is (3S)-tricyclo[5.2.1.02,6]deca-1,6,8-triene-3-carbaldehyde.
| Compound Name | (3S)-tricyclo[5.2.1.02,6]deca-1,6,8-triene-3-carbaldehyde |
|---|---|
| PubChem CID | 155093037 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (3S)-tricyclo[5.2.1.02,6]deca-1,6,8-triene-3-carbaldehyde |
| SMILES | O=C[C@H]1CCC2=C3C=CC(=C21)C3 |
| InChI | InChI=1S/C11H10O/c12-6-9-3-4-10-7-1-2-8(5-7)11(9)10/h1-2,6,9H,3-5H2/t9-/m1/s1 |
| InChIKey | PIVHUAFNGNQSFD-SECBINFHSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|