About [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid
[(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid (PubChem CID 155093279) has the molecular formula C12H13F3N4O4
and a molecular weight of 334.25 g/mol. Its IUPAC name is [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid |
| PubChem CID | 155093279 |
| Molecular Formula | C12H13F3N4O4 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@@H](C(=O)Nc2cnc(C(F)(F)F)cn2)OC1 |
| InChI | InChI=1S/C12H13F3N4O4/c13-12(14,15)8-3-17-9(4-16-8)19-10(20)7-2-1-6(5-23-7)18-11(21)22/h3-4,6-7,18H,1-2,5H2,(H,21,22)(H,17,19,20)/t6-,7+/m1/s1 |
| InChIKey | GSFPOFJYBAONIP-RQJHMYQMSA-N |
| XLogP | 1.25 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid?
The IUPAC name of [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid (CID 155093279) is [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid.
What is the SMILES notation for [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid?
The canonical SMILES for [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid is O=C(O)N[C@@H]1CC[C@@H](C(=O)Nc2cnc(C(F)(F)F)cn2)OC1.
What is the InChIKey of [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid?
The InChIKey is GSFPOFJYBAONIP-RQJHMYQMSA-N. The full InChI is InChI=1S/C12H13F3N4O4/c13-12(14,15)8-3-17-9(4-16-8)19-10(20)7-2-1-6(5-23-7)18-11(21)22/h3-4,6-7,18H,1-2,5H2,(H,21,22)(H,17,19,20)/t6-,7+/m1/s1.
What are the key properties of [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid?
[(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid has a molecular weight of 334.25 g/mol, XLogP of 1.25, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6S)-6-[[5-(trifluoromethyl)pyrazin-2-yl]carbamoyl]oxan-3-yl]carbamic acid is sourced from PubChem (CID 155093279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).