C25H47NO9 — CID 155093498
ditert-butyl 2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethylamino]butanedioate (PubChem CID 155093498) has the molecular formula C25H47NO9 and a molecular weight of 505.65 g/mol. Its IUPAC name is ditert-butyl 2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethylamino]butanedioate.
| Compound Name | ditert-butyl 2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethylamino]butanedioate |
|---|---|
| PubChem CID | 155093498 |
| Molecular Formula | C25H47NO9 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | ditert-butyl 2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCNC(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H47NO9/c1-23(2,3)33-20(27)10-12-30-14-16-32-17-15-31-13-11-26-19(22(29)35-25(7,8)9)18-21(28)34-24(4,5)6/h19,26H,10-18H2,1-9H3 |
| InChIKey | URTWTBFJJCMJQV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|