C26H52N2O7 — CID 155094747
1-tert-butyl-3-[4,6-dihydroxy-7,7,9,9-tetramethyl-1-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]decan-3-yl]urea (PubChem CID 155094747) has the molecular formula C26H52N2O7 and a molecular weight of 504.71 g/mol. Its IUPAC name is 1-tert-butyl-3-[4,6-dihydroxy-7,7,9,9-tetramethyl-1-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]decan-3-yl]urea.
| Compound Name | 1-tert-butyl-3-[4,6-dihydroxy-7,7,9,9-tetramethyl-1-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]decan-3-yl]urea |
|---|---|
| PubChem CID | 155094747 |
| Molecular Formula | C26H52N2O7 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | 1-tert-butyl-3-[4,6-dihydroxy-7,7,9,9-tetramethyl-1-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]decan-3-yl]urea |
| SMILES | CC(C)(C)CC(C)(C)C(O)CC(O)C(CCC1CC(CO)C(O)C(O)C1O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H52N2O7/c1-24(2,3)14-26(7,8)19(31)12-18(30)17(27-23(35)28-25(4,5)6)10-9-15-11-16(13-29)21(33)22(34)20(15)32/h15-22,29-34H,9-14H2,1-8H3,(H2,27,28,35) |
| InChIKey | LYHUKLGFLZBTAX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |