C26H35N5O2 — CID 155095275
4-ethyl-2-[2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-7-(piperidin-4-ylamino)-3,4-dihydro-2,6-naphthyridin-1-one (PubChem CID 155095275) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 4-ethyl-2-[2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-7-(piperidin-4-ylamino)-3,4-dihydro-2,6-naphthyridin-1-one.
| Compound Name | 4-ethyl-2-[2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-7-(piperidin-4-ylamino)-3,4-dihydro-2,6-naphthyridin-1-one |
|---|---|
| PubChem CID | 155095275 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 4-ethyl-2-[2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-7-(piperidin-4-ylamino)-3,4-dihydro-2,6-naphthyridin-1-one |
| SMILES | CCC1CN(CC(O)[C@@H]2Cc3ccccc3CN2)C(=O)c2cc(NC3CCNCC3)ncc21 |
| InChI | InChI=1S/C26H35N5O2/c1-2-17-15-31(16-24(32)23-11-18-5-3-4-6-19(18)13-28-23)26(33)21-12-25(29-14-22(17)21)30-20-7-9-27-10-8-20/h3-6,12,14,17,20,23-24,27-28,32H,2,7-11,13,15-16H2,1H3,(H,29,30)/t17?,23-,24?/m0/s1 |
| InChIKey | SHMBMEVKOMCRQX-JXKJCSFESA-N |
| XLogP | 2.27 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |