C19H23F3N4OS — CID 155095396
N'-[2,5-dimethyl-4-[2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 155095396) has the molecular formula C19H23F3N4OS and a molecular weight of 412.48 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 155095396 |
| Molecular Formula | C19H23F3N4OS |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N'-[2,5-dimethyl-4-[2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-yl]oxyphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2ccnc(SCCC(F)(F)F)n2)cc1C |
| InChI | InChI=1S/C19H23F3N4OS/c1-5-26(4)12-24-15-10-14(3)16(11-13(15)2)27-17-6-8-23-18(25-17)28-9-7-19(20,21)22/h6,8,10-12H,5,7,9H2,1-4H3/b24-12+ |
| InChIKey | ODVHDHVQQSEXJN-WYMPLXKRSA-N |
| XLogP | 5.54 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|