About 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine
2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine (PubChem CID 155095863) has the molecular formula C19H25NS
and a molecular weight of 299.48 g/mol. Its IUPAC name is 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine.
Molecular Properties
| Compound Name | 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine |
| PubChem CID | 155095863 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine |
| SMILES | C=CC(=C)S/C(C)=C(/C)c1ccc(C2CCCCC2)cn1 |
| InChI | InChI=1S/C19H25NS/c1-5-14(2)21-16(4)15(3)19-12-11-18(13-20-19)17-9-7-6-8-10-17/h5,11-13,17H,1-2,6-10H2,3-4H3/b16-15- |
| InChIKey | NHTCILLQADYMIJ-NXVVXOECSA-N |
| XLogP | 6.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine?
The IUPAC name of 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine (CID 155095863) is 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine.
What is the SMILES notation for 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine?
The canonical SMILES for 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine is C=CC(=C)S/C(C)=C(/C)c1ccc(C2CCCCC2)cn1.
What is the InChIKey of 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine?
The InChIKey is NHTCILLQADYMIJ-NXVVXOECSA-N. The full InChI is InChI=1S/C19H25NS/c1-5-14(2)21-16(4)15(3)19-12-11-18(13-20-19)17-9-7-6-8-10-17/h5,11-13,17H,1-2,6-10H2,3-4H3/b16-15-.
What are the key properties of 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine?
2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine has a molecular weight of 299.48 g/mol, XLogP of 6.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3-buta-1,3-dien-2-ylsulfanylbut-2-en-2-yl]-5-cyclohexylpyridine is sourced from PubChem (CID 155095863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).