C24H38N2 — CID 155095901
(4Z,6Z)-2,2-dimethyl-N-[4-(methylideneamino)-5-[(2E)-penta-2,4-dien-2-yl]cyclooctyl]octa-4,6-dien-1-imine (PubChem CID 155095901) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is (4Z,6Z)-2,2-dimethyl-N-[4-(methylideneamino)-5-[(2E)-penta-2,4-dien-2-yl]cyclooctyl]octa-4,6-dien-1-imine.
| Compound Name | (4Z,6Z)-2,2-dimethyl-N-[4-(methylideneamino)-5-[(2E)-penta-2,4-dien-2-yl]cyclooctyl]octa-4,6-dien-1-imine |
|---|---|
| PubChem CID | 155095901 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (4Z,6Z)-2,2-dimethyl-N-[4-(methylideneamino)-5-[(2E)-penta-2,4-dien-2-yl]cyclooctyl]octa-4,6-dien-1-imine |
| SMILES | C=C/C=C(\C)C1CCCC(/N=C/C(C)(C)C/C=C\C=C/C)CCC1N=C |
| InChI | InChI=1S/C24H38N2/c1-7-9-10-11-18-24(4,5)19-26-21-14-12-15-22(20(3)13-8-2)23(25-6)17-16-21/h7-11,13,19,21-23H,2,6,12,14-18H2,1,3-5H3/b9-7-,11-10-,20-13+,26-19+ |
| InChIKey | ZDFHKBPZFCAGHJ-OZKAMMSASA-N |
| XLogP | 6.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|