C27H34O2 — CID 155096412
2-phenyl-1-(2,4,6-trimethylcyclohexyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione (PubChem CID 155096412) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-phenyl-1-(2,4,6-trimethylcyclohexyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione.
| Compound Name | 2-phenyl-1-(2,4,6-trimethylcyclohexyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 155096412 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 2-phenyl-1-(2,4,6-trimethylcyclohexyl)-3-(2,4,6-trimethylphenyl)propane-1,3-dione |
| SMILES | Cc1cc(C)c(C(=O)C(C(=O)C2C(C)CC(C)CC2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C27H34O2/c1-16-12-18(3)23(19(4)13-16)26(28)25(22-10-8-7-9-11-22)27(29)24-20(5)14-17(2)15-21(24)6/h7-13,17,20-21,24-25H,14-15H2,1-6H3 |
| InChIKey | YKEUJKHQZXDOEP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|