C29H26N4O2 — CID 155096500
N-methyl-N-(2-phenoxyethyl)-2-(6-phenylmethoxy-3-pyridinyl)quinazolin-4-amine (PubChem CID 155096500) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-methyl-N-(2-phenoxyethyl)-2-(6-phenylmethoxy-3-pyridinyl)quinazolin-4-amine.
| Compound Name | N-methyl-N-(2-phenoxyethyl)-2-(6-phenylmethoxy-3-pyridinyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 155096500 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-methyl-N-(2-phenoxyethyl)-2-(6-phenylmethoxy-3-pyridinyl)quinazolin-4-amine |
| SMILES | CN(CCOc1ccccc1)c1nc(-c2ccc(OCc3ccccc3)nc2)nc2ccccc12 |
| InChI | InChI=1S/C29H26N4O2/c1-33(18-19-34-24-12-6-3-7-13-24)29-25-14-8-9-15-26(25)31-28(32-29)23-16-17-27(30-20-23)35-21-22-10-4-2-5-11-22/h2-17,20H,18-19,21H2,1H3 |
| InChIKey | MUXZWULFYNCRIS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |