C16H17F3O8S — CID 15509721
[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate (PubChem CID 15509721) has the molecular formula C16H17F3O8S and a molecular weight of 426.37 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 15509721 |
| Molecular Formula | C16H17F3O8S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H](COC(=O)c3ccccc3)[C@H](OS(=O)(=O)C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C16H17F3O8S/c1-15(2)25-12-11(27-28(21,22)16(17,18)19)10(24-14(12)26-15)8-23-13(20)9-6-4-3-5-7-9/h3-7,10-12,14H,8H2,1-2H3/t10-,11+,12-,14-/m1/s1 |
| InChIKey | VCVYUEWKLVFSAK-GFQSEFKGSA-N |
| XLogP | 1.95 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|