About 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole
5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole (PubChem CID 155097383) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 155097383 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole |
| SMILES | CCC1=C(C(C)C)Cc2cncn21 |
| InChI | InChI=1S/C11H16N2/c1-4-11-10(8(2)3)5-9-6-12-7-13(9)11/h6-8H,4-5H2,1-3H3 |
| InChIKey | BTOWDMDIPDFLOH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole (CID 155097383) is 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole is CCC1=C(C(C)C)Cc2cncn21.
What is the InChIKey of 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole?
The InChIKey is BTOWDMDIPDFLOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-4-11-10(8(2)3)5-9-6-12-7-13(9)11/h6-8H,4-5H2,1-3H3.
What are the key properties of 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole?
5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole has a molecular weight of 176.26 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-6-propan-2-yl-7H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 155097383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).