C8H17NOS — CID 155097445
3-methyl-1-[propan-2-yl(sulfanyl)amino]butan-2-one (PubChem CID 155097445) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is 3-methyl-1-[propan-2-yl(sulfanyl)amino]butan-2-one.
| Compound Name | 3-methyl-1-[propan-2-yl(sulfanyl)amino]butan-2-one |
|---|---|
| PubChem CID | 155097445 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-methyl-1-[propan-2-yl(sulfanyl)amino]butan-2-one |
| SMILES | CC(C)C(=O)CN(S)C(C)C |
| InChI | InChI=1S/C8H17NOS/c1-6(2)8(10)5-9(11)7(3)4/h6-7,11H,5H2,1-4H3 |
| InChIKey | ARVMFTXVIFBBBQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|