C18H21ClN4O6 — CID 155098695
4-[4-(2-chloro-4-nitrobenzoyl)piperazine-1-carbonyl]piperidine-1-carboxylic acid (PubChem CID 155098695) has the molecular formula C18H21ClN4O6 and a molecular weight of 424.84 g/mol. Its IUPAC name is 4-[4-(2-chloro-4-nitrobenzoyl)piperazine-1-carbonyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-(2-chloro-4-nitrobenzoyl)piperazine-1-carbonyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155098695 |
| Molecular Formula | C18H21ClN4O6 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[4-(2-chloro-4-nitrobenzoyl)piperazine-1-carbonyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(C(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C18H21ClN4O6/c19-15-11-13(23(28)29)1-2-14(15)17(25)21-9-7-20(8-10-21)16(24)12-3-5-22(6-4-12)18(26)27/h1-2,11-12H,3-10H2,(H,26,27) |
| InChIKey | IMZHTWAGLRCOKD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|