About 1,2-dibromo-4-(2,4-dibromophenoxy)benzene
1,2-dibromo-4-(2,4-dibromophenoxy)benzene (PubChem CID 15509893) has the molecular formula C12H6Br4O
and a molecular weight of 485.80 g/mol. Its IUPAC name is 1,2-dibromo-4-(2,4-dibromophenoxy)benzene.
Molecular Properties
| Compound Name | 1,2-dibromo-4-(2,4-dibromophenoxy)benzene |
| PubChem CID | 15509893 |
| Molecular Formula | C12H6Br4O |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 481.72 |
| IUPAC Name | 1,2-dibromo-4-(2,4-dibromophenoxy)benzene |
| SMILES | Brc1ccc(Oc2ccc(Br)c(Br)c2)c(Br)c1 |
| InChI | InChI=1S/C12H6Br4O/c13-7-1-4-12(11(16)5-7)17-8-2-3-9(14)10(15)6-8/h1-6H |
| InChIKey | DHUMTYRHKMCVAG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dibromo-4-(2,4-dibromophenoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromo-4-(2,4-dibromophenoxy)benzene?
The IUPAC name of 1,2-dibromo-4-(2,4-dibromophenoxy)benzene (CID 15509893) is 1,2-dibromo-4-(2,4-dibromophenoxy)benzene.
What is the SMILES notation for 1,2-dibromo-4-(2,4-dibromophenoxy)benzene?
The canonical SMILES for 1,2-dibromo-4-(2,4-dibromophenoxy)benzene is Brc1ccc(Oc2ccc(Br)c(Br)c2)c(Br)c1.
What is the InChIKey of 1,2-dibromo-4-(2,4-dibromophenoxy)benzene?
The InChIKey is DHUMTYRHKMCVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br4O/c13-7-1-4-12(11(16)5-7)17-8-2-3-9(14)10(15)6-8/h1-6H.
What are the key properties of 1,2-dibromo-4-(2,4-dibromophenoxy)benzene?
1,2-dibromo-4-(2,4-dibromophenoxy)benzene has a molecular weight of 485.80 g/mol, XLogP of 6.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromo-4-(2,4-dibromophenoxy)benzene is sourced from PubChem (CID 15509893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).