C12H4Cl2F12N2 — CID 15509917
N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanimidamide (PubChem CID 15509917) has the molecular formula C12H4Cl2F12N2 and a molecular weight of 475.06 g/mol. Its IUPAC name is N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanimidamide.
| Compound Name | N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanimidamide |
|---|---|
| PubChem CID | 15509917 |
| Molecular Formula | C12H4Cl2F12N2 |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanimidamide |
| SMILES | N/C(=N\c1c(Cl)cc(C(F)(F)F)cc1Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4Cl2F12N2/c13-4-1-3(9(17,18)19)2-5(14)6(4)28-7(27)8(15,16)10(20,21)11(22,23)12(24,25)26/h1-2H,(H2,27,28) |
| InChIKey | GIADOSGYOFULJR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|