About 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine
1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine (PubChem CID 155100110) has the molecular formula C14H22N6O2S
and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine |
| PubChem CID | 155100110 |
| Molecular Formula | C14H22N6O2S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine |
| SMILES | Cn1ncc2c(N3CCC(CCNS(N)(=O)=O)CC3)ccnc21 |
| InChI | InChI=1S/C14H22N6O2S/c1-19-14-12(10-17-19)13(3-6-16-14)20-8-4-11(5-9-20)2-7-18-23(15,21)22/h3,6,10-11,18H,2,4-5,7-9H2,1H3,(H2,15,21,22) |
| InChIKey | SXIOFOSWWBFEKI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine?
The IUPAC name of 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine (CID 155100110) is 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine?
The canonical SMILES for 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine is Cn1ncc2c(N3CCC(CCNS(N)(=O)=O)CC3)ccnc21.
What is the InChIKey of 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine?
The InChIKey is SXIOFOSWWBFEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6O2S/c1-19-14-12(10-17-19)13(3-6-16-14)20-8-4-11(5-9-20)2-7-18-23(15,21)22/h3,6,10-11,18H,2,4-5,7-9H2,1H3,(H2,15,21,22).
What are the key properties of 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine?
1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine has a molecular weight of 338.44 g/mol, XLogP of 0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 155100110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).