About 1,4-dichlorobenzene;naphthalene
1,4-dichlorobenzene;naphthalene (PubChem CID 155100603) has the molecular formula C16H12Cl2
and a molecular weight of 275.18 g/mol. Its IUPAC name is 1,4-dichlorobenzene;naphthalene.
Molecular Properties
| Compound Name | 1,4-dichlorobenzene;naphthalene |
| PubChem CID | 155100603 |
| Molecular Formula | C16H12Cl2 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1,4-dichlorobenzene;naphthalene |
| SMILES | Clc1ccc(Cl)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H4Cl2/c1-2-6-10-8-4-3-7-9(10)5-1;7-5-1-2-6(8)4-3-5/h1-8H;1-4H |
| InChIKey | RGTQXJDRBSKQHF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dichlorobenzene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichlorobenzene;naphthalene?
The IUPAC name of 1,4-dichlorobenzene;naphthalene (CID 155100603) is 1,4-dichlorobenzene;naphthalene.
What is the SMILES notation for 1,4-dichlorobenzene;naphthalene?
The canonical SMILES for 1,4-dichlorobenzene;naphthalene is Clc1ccc(Cl)cc1.c1ccc2ccccc2c1.
What is the InChIKey of 1,4-dichlorobenzene;naphthalene?
The InChIKey is RGTQXJDRBSKQHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C6H4Cl2/c1-2-6-10-8-4-3-7-9(10)5-1;7-5-1-2-6(8)4-3-5/h1-8H;1-4H.
What are the key properties of 1,4-dichlorobenzene;naphthalene?
1,4-dichlorobenzene;naphthalene has a molecular weight of 275.18 g/mol, XLogP of 5.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichlorobenzene;naphthalene is sourced from PubChem (CID 155100603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).