About 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid
1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid (PubChem CID 155101041) has the molecular formula C16H22FNO5
and a molecular weight of 327.35 g/mol. Its IUPAC name is 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid.
Molecular Properties
| Compound Name | 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid |
| PubChem CID | 155101041 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid |
| SMILES | CNCC1OCCc2cccc(F)c21.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C11H14FNO.C5H8O4/c1-13-7-10-11-8(5-6-14-10)3-2-4-9(11)12;6-4(7)2-1-3-5(8)9/h2-4,10,13H,5-7H2,1H3;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | LNHAMIGTJJZMPG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid?
The IUPAC name of 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid (CID 155101041) is 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid.
What is the SMILES notation for 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid?
The canonical SMILES for 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid is CNCC1OCCc2cccc(F)c21.O=C(O)CCCC(=O)O.
What is the InChIKey of 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid?
The InChIKey is LNHAMIGTJJZMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO.C5H8O4/c1-13-7-10-11-8(5-6-14-10)3-2-4-9(11)12;6-4(7)2-1-3-5(8)9/h2-4,10,13H,5-7H2,1H3;1-3H2,(H,6,7)(H,8,9).
What are the key properties of 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid?
1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid has a molecular weight of 327.35 g/mol, XLogP of 1.98, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine;pentanedioic acid is sourced from PubChem (CID 155101041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).