C13H12N2O — CID 155101991
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[3,2-d]pyrimidine (PubChem CID 155101991) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[3,2-d]pyrimidine.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155101991 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]furo[3,2-d]pyrimidine |
| SMILES | C=C/C=C(\C=C/C)c1ncnc2ccoc12 |
| InChI | InChI=1S/C13H12N2O/c1-3-5-10(6-4-2)12-13-11(7-8-16-13)14-9-15-12/h3-9H,1H2,2H3/b6-4-,10-5+ |
| InChIKey | IPYWUWKOPCIZRI-KNVSICBPSA-N |
| XLogP | 3.37 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|