C24H21Cl2N3O4S — CID 155102036
ethyl 4-[(6R)-7-(3,4-dichlorobenzoyl)-6-methyl-4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl]benzoate (PubChem CID 155102036) has the molecular formula C24H21Cl2N3O4S and a molecular weight of 518.42 g/mol. Its IUPAC name is ethyl 4-[(6R)-7-(3,4-dichlorobenzoyl)-6-methyl-4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl]benzoate.
| Compound Name | ethyl 4-[(6R)-7-(3,4-dichlorobenzoyl)-6-methyl-4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl]benzoate |
|---|---|
| PubChem CID | 155102036 |
| Molecular Formula | C24H21Cl2N3O4S |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | ethyl 4-[(6R)-7-(3,4-dichlorobenzoyl)-6-methyl-4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(=S)[nH]c3c(c2=O)C[C@@H](C)N(C(=O)c2ccc(Cl)c(Cl)c2)C3)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O4S/c1-3-33-23(32)14-4-7-16(8-5-14)29-22(31)17-10-13(2)28(12-20(17)27-24(29)34)21(30)15-6-9-18(25)19(26)11-15/h4-9,11,13H,3,10,12H2,1-2H3,(H,27,34)/t13-/m1/s1 |
| InChIKey | BOYQCOYNXVZOCU-CYBMUJFWSA-N |
| XLogP | 4.97 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|