C21H21ClN6O7 — CID 155102980
[6-chloro-3-[[3-[(4-methoxy-3-nitrophenyl)methoxy]cyclobutyl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid (PubChem CID 155102980) has the molecular formula C21H21ClN6O7 and a molecular weight of 504.89 g/mol. Its IUPAC name is [6-chloro-3-[[3-[(4-methoxy-3-nitrophenyl)methoxy]cyclobutyl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid.
| Compound Name | [6-chloro-3-[[3-[(4-methoxy-3-nitrophenyl)methoxy]cyclobutyl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 155102980 |
| Molecular Formula | C21H21ClN6O7 |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [6-chloro-3-[[3-[(4-methoxy-3-nitrophenyl)methoxy]cyclobutyl]carbamoyl]imidazo[1,2-b]pyridazin-8-yl]-methylcarbamic acid |
| SMILES | COc1ccc(COC2CC(NC(=O)c3cnc4c(N(C)C(=O)O)cc(Cl)nn34)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21ClN6O7/c1-26(21(30)31)15-8-18(22)25-27-16(9-23-19(15)27)20(29)24-12-6-13(7-12)35-10-11-3-4-17(34-2)14(5-11)28(32)33/h3-5,8-9,12-13H,6-7,10H2,1-2H3,(H,24,29)(H,30,31) |
| InChIKey | MICXCTKQRZFCHV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 161.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|