C15H18F3N3O4S — CID 155103108
5-[(7R)-7-(3,3-difluoropropylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103108) has the molecular formula C15H18F3N3O4S and a molecular weight of 393.39 g/mol. Its IUPAC name is 5-[(7R)-7-(3,3-difluoropropylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-7-(3,3-difluoropropylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103108 |
| Molecular Formula | C15H18F3N3O4S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 5-[(7R)-7-(3,3-difluoropropylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCCC(F)F)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H18F3N3O4S/c16-12(17)3-4-19-9-2-1-8-5-11(22)15(14(18)10(8)6-9)21-7-13(23)20-26(21,24)25/h5,9,12,19,22H,1-4,6-7H2,(H,20,23)/t9-/m1/s1 |
| InChIKey | KALOTWGFLPBDMF-SECBINFHSA-N |
| XLogP | 0.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |